C13H19N4O11P — CID 163026471
4-[[5-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 163026471) has the molecular formula C13H19N4O11P and a molecular weight of 438.29 g/mol. Its IUPAC name is 4-[[5-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[5-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163026471 |
| Molecular Formula | C13H19N4O11P |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 4-[[5-amino-1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | Nc1c(C(=O)NC(=O)CCC(=O)O)ncn1[C@@H]1O[C@@H](COP(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N4O11P/c14-11-8(12(23)16-6(18)1-2-7(19)20)15-4-17(11)13-10(22)9(21)5(28-13)3-27-29(24,25)26/h4-5,9-10,13,21-22H,1-3,14H2,(H,19,20)(H,16,18,23)(H2,24,25,26)/t5-,9-,10+,13+/m0/s1 |
| InChIKey | RWVTVGQLTDIUSF-HXFUSZJKSA-N |
| XLogP | -2.68 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|