C17H22N5O10P — CID 163755066
[(2R,3S,4R,5R)-5-[5-amino-4-[2-[(4-nitrophenyl)methylamino]acetyl]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 163755066) has the molecular formula C17H22N5O10P and a molecular weight of 487.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-amino-4-[2-[(4-nitrophenyl)methylamino]acetyl]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-amino-4-[2-[(4-nitrophenyl)methylamino]acetyl]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163755066 |
| Molecular Formula | C17H22N5O10P |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-amino-4-[2-[(4-nitrophenyl)methylamino]acetyl]imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1c(C(=O)CNCc2ccc([N+](=O)[O-])cc2)ncn1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H22N5O10P/c18-16-13(11(23)6-19-5-9-1-3-10(4-2-9)22(26)27)20-8-21(16)17-15(25)14(24)12(32-17)7-31-33(28,29)30/h1-4,8,12,14-15,17,19,24-25H,5-7,18H2,(H2,28,29,30)/t12-,14-,15-,17-/m1/s1 |
| InChIKey | LTIXNNCRHFIIRE-DNNBLBMLSA-N |
| XLogP | -0.93 |
| TPSA | 232.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|