C12H19N4O8P — CID 101084770
[(2R,3S,4R,5R)-5-[5-amino-4-(prop-2-enylcarbamoyl)imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 101084770) has the molecular formula C12H19N4O8P and a molecular weight of 378.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-amino-4-(prop-2-enylcarbamoyl)imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-amino-4-(prop-2-enylcarbamoyl)imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 101084770 |
| Molecular Formula | C12H19N4O8P |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-amino-4-(prop-2-enylcarbamoyl)imidazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=CCNC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1N |
| InChI | InChI=1S/C12H19N4O8P/c1-2-3-14-11(19)7-10(13)16(5-15-7)12-9(18)8(17)6(24-12)4-23-25(20,21)22/h2,5-6,8-9,12,17-18H,1,3-4,13H2,(H,14,19)(H2,20,21,22)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | PBFTVIIPDHYZBY-WOUKDFQISA-N |
| XLogP | -1.89 |
| TPSA | 189.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|