C16H22N4O6 — CID 54170270
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-N,5-N-bis(prop-2-enyl)imidazole-4,5-dicarboxamide (PubChem CID 54170270) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-N,5-N-bis(prop-2-enyl)imidazole-4,5-dicarboxamide.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-N,5-N-bis(prop-2-enyl)imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 54170270 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-N,5-N-bis(prop-2-enyl)imidazole-4,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1C(=O)NCC=C |
| InChI | InChI=1S/C16H22N4O6/c1-3-5-17-14(24)10-11(15(25)18-6-4-2)20(8-19-10)16-13(23)12(22)9(7-21)26-16/h3-4,8-9,12-13,16,21-23H,1-2,5-7H2,(H,17,24)(H,18,25)/t9-,12-,13-,16-/m1/s1 |
| InChIKey | OUNJTNSLTMHQNA-RVXWVPLUSA-N |
| XLogP | -1.67 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|