C9H13N6O6P — CID 68776185
[5-(7-aminotriazolo[4,5-d]pyrimidin-2-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid (PubChem CID 68776185) has the molecular formula C9H13N6O6P and a molecular weight of 332.21 g/mol. Its IUPAC name is [5-(7-aminotriazolo[4,5-d]pyrimidin-2-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid.
| Compound Name | [5-(7-aminotriazolo[4,5-d]pyrimidin-2-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 68776185 |
| Molecular Formula | C9H13N6O6P |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [5-(7-aminotriazolo[4,5-d]pyrimidin-2-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid |
| SMILES | Nc1ncnc2nn(C3OC(OCP(=O)(O)O)CC3O)nc12 |
| InChI | InChI=1S/C9H13N6O6P/c10-7-6-8(12-2-11-7)14-15(13-6)9-4(16)1-5(21-9)20-3-22(17,18)19/h2,4-5,9,16H,1,3H2,(H2,17,18,19)(H2,10,11,12,14) |
| InChIKey | ZMVPNQAATHEHGZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 178.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|