C10H13BrN5O7P — CID 140738377
[(2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy methyl hydrogen phosphate (PubChem CID 140738377) has the molecular formula C10H13BrN5O7P and a molecular weight of 426.12 g/mol. Its IUPAC name is [(2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy methyl hydrogen phosphate |
|---|---|
| PubChem CID | 140738377 |
| Molecular Formula | C10H13BrN5O7P |
| Molecular Weight | 426.12 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | [(2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OO[C@@H]1CC(O)[C@H](n2c(Br)nc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C10H13BrN5O7P/c1-20-24(18,19)23-22-5-2-4(17)9(21-5)16-8-6(15-10(16)11)7(12)13-3-14-8/h3-5,9,17H,2H2,1H3,(H,18,19)(H2,12,13,14)/t4?,5-,9-/m1/s1 |
| InChIKey | DZHKVRMLJFIVIK-KHYXMFBRSA-N |
| XLogP | 0.47 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.12 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|