C11H15BrN5O6P — CID 153438407
[(2S,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate (PubChem CID 153438407) has the molecular formula C11H15BrN5O6P and a molecular weight of 424.15 g/mol. Its IUPAC name is [(2S,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate.
| Compound Name | [(2S,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 153438407 |
| Molecular Formula | C11H15BrN5O6P |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | [(2S,5R)-5-(6-amino-8-bromopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC[C@@H]1CC(O)[C@H](n2c(Br)nc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C11H15BrN5O6P/c1-21-24(19,20)22-3-5-2-6(18)10(23-5)17-9-7(16-11(17)12)8(13)14-4-15-9/h4-6,10,18H,2-3H2,1H3,(H,19,20)(H2,13,14,15)/t5-,6?,10+/m0/s1 |
| InChIKey | LMZNIWHNOSTXHW-GZRQHRFASA-N |
| XLogP | 0.58 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|