C30H26N6O5 — CID 51361630
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-(naphthalen-1-ylmethylamino)-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 51361630) has the molecular formula C30H26N6O5 and a molecular weight of 550.58 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-(naphthalen-1-ylmethylamino)-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-(naphthalen-1-ylmethylamino)-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 51361630 |
| Molecular Formula | C30H26N6O5 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-(naphthalen-1-ylmethylamino)-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(/C=C/[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H26N6O5/c37-23(31-15-20-11-6-10-18-7-4-5-12-21(18)20)14-13-22-25(38)26(39)30(41-22)36-17-34-24-27(32-16-33-28(24)36)35-29(40)19-8-2-1-3-9-19/h1-14,16-17,22,25-26,30,38-39H,15H2,(H,31,37)(H,32,33,35,40)/b14-13+/t22-,25-,26-,30-/m1/s1 |
| InChIKey | IAMFWMQMNPKWEZ-HAVZWTCJSA-N |
| XLogP | 2.72 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|