C17H17N6O7P — CID 91182958
2-[(2R,3S,4R,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenylphosphonic acid (PubChem CID 91182958) has the molecular formula C17H17N6O7P and a molecular weight of 448.33 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenylphosphonic acid |
|---|---|
| PubChem CID | 91182958 |
| Molecular Formula | C17H17N6O7P |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-(7-benzamidotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenylphosphonic acid |
| SMILES | O=C(Nc1ncnc2c1nnn2[C@@H]1O[C@H](C=CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C17H17N6O7P/c24-12-10(6-7-31(27,28)29)30-17(13(12)25)23-15-11(21-22-23)14(18-8-19-15)20-16(26)9-4-2-1-3-5-9/h1-8,10,12-13,17,24-25H,(H2,27,28,29)(H,18,19,20,26)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | PFJXAGYOWNHGKL-CNEMSGBDSA-N |
| XLogP | -0.22 |
| TPSA | 192.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|