C10H15N6O12P3 — CID 90838874
2-[(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 90838874) has the molecular formula C10H15N6O12P3 and a molecular weight of 504.18 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 90838874 |
| Molecular Formula | C10H15N6O12P3 |
| Molecular Weight | 504.18 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | Nc1ncnc2c1nnn2[C@@H]1O[C@H](C=CP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N6O12P3/c11-8-5-9(13-3-12-8)16(15-14-5)10-7(18)6(17)4(26-10)1-2-29(19,20)27-31(24,25)28-30(21,22)23/h1-4,6-7,10,17-18H,(H,19,20)(H,24,25)(H2,11,12,13)(H2,21,22,23)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | XSTVOIXNZBSRRF-KQYNXXCUSA-N |
| XLogP | -1.65 |
| TPSA | 282.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.18 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|