C13H18N6O2 — CID 59289225
(2R,3R,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol (PubChem CID 59289225) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is (2R,3R,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol |
|---|---|
| PubChem CID | 59289225 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2R,3R,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol |
| SMILES | CC(C)/C=C/[C@@H]1C[C@@H](O)[C@H](n2nnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C13H18N6O2/c1-7(2)3-4-8-5-9(20)13(21-8)19-12-10(17-18-19)11(14)15-6-16-12/h3-4,6-9,13,20H,5H2,1-2H3,(H2,14,15,16)/b4-3+/t8-,9-,13-/m1/s1 |
| InChIKey | DRRZGUSXWFCCPA-HTRKHQCYSA-N |
| XLogP | 0.66 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|