C12H18N6 — CID 139296107
3-(3-ethylcyclohexyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 139296107) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 3-(3-ethylcyclohexyl)triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-(3-ethylcyclohexyl)triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 139296107 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 3-(3-ethylcyclohexyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCC1CCCC(n2nnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C12H18N6/c1-2-8-4-3-5-9(6-8)18-12-10(16-17-18)11(13)14-7-15-12/h7-9H,2-6H2,1H3,(H2,13,14,15) |
| InChIKey | ATCVZZPMJXIWRT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |