C18H22N6O — CID 139295787
3-[3-(phenylmethoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 139295787) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[3-(phenylmethoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-[3-(phenylmethoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 139295787 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-[3-(phenylmethoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2c1nnn2C1CCCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C18H22N6O/c19-17-16-18(21-12-20-17)24(23-22-16)15-8-4-7-14(9-15)11-25-10-13-5-2-1-3-6-13/h1-3,5-6,12,14-15H,4,7-11H2,(H2,19,20,21) |
| InChIKey | NRUBWVNDWCVCGG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |