C17H20N6O — CID 139295533
3-[3-(phenoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 139295533) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 3-[3-(phenoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-[3-(phenoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 139295533 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[3-(phenoxymethyl)cyclohexyl]triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2c1nnn2C1CCCC(COc2ccccc2)C1 |
| InChI | InChI=1S/C17H20N6O/c18-16-15-17(20-11-19-16)23(22-21-15)13-6-4-5-12(9-13)10-24-14-7-2-1-3-8-14/h1-3,7-8,11-13H,4-6,9-10H2,(H2,18,19,20) |
| InChIKey | NWVXSSJVQXRRGB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |