C13H16IN5O2 — CID 154996492
2-[(1R,3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]acetic acid (PubChem CID 154996492) has the molecular formula C13H16IN5O2 and a molecular weight of 401.21 g/mol. Its IUPAC name is 2-[(1R,3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]acetic acid.
| Compound Name | 2-[(1R,3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 154996492 |
| Molecular Formula | C13H16IN5O2 |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 2-[(1R,3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]acetic acid |
| SMILES | Nc1ncnc2c1c(I)nn2[C@@H]1CCC[C@@H](CC(=O)O)C1 |
| InChI | InChI=1S/C13H16IN5O2/c14-11-10-12(15)16-6-17-13(10)19(18-11)8-3-1-2-7(4-8)5-9(20)21/h6-8H,1-5H2,(H,20,21)(H2,15,16,17)/t7-,8-/m1/s1 |
| InChIKey | TVTNHWVITBRZCW-HTQZYQBOSA-N |
| XLogP | 2.22 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|