C14H15IN6O — CID 175016703
1-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]but-2-yn-1-one (PubChem CID 175016703) has the molecular formula C14H15IN6O and a molecular weight of 410.22 g/mol. Its IUPAC name is 1-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 175016703 |
| Molecular Formula | C14H15IN6O |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 1-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCC(n2nc(I)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C14H15IN6O/c1-2-4-10(22)20-6-3-5-9(7-20)21-14-11(12(15)19-21)13(16)17-8-18-14/h8-9H,3,5-7H2,1H3,(H2,16,17,18) |
| InChIKey | QKCGFGKMGVNXPY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|