C14H19IN6O — CID 134259429
1-[(3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]butan-1-one (PubChem CID 134259429) has the molecular formula C14H19IN6O and a molecular weight of 414.25 g/mol. Its IUPAC name is 1-[(3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 1-[(3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 134259429 |
| Molecular Formula | C14H19IN6O |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-[(3R)-3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCC[C@@H](n2nc(I)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C14H19IN6O/c1-2-4-10(22)20-6-3-5-9(7-20)21-14-11(12(15)19-21)13(16)17-8-18-14/h8-9H,2-7H2,1H3,(H2,16,17,18)/t9-/m1/s1 |
| InChIKey | SWGFLKMWAOYDRJ-SECBINFHSA-N |
| XLogP | 1.98 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|