C11H12IN5 — CID 135356347
1-cyclohex-2-en-1-yl-3-iodopyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 135356347) has the molecular formula C11H12IN5 and a molecular weight of 341.16 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-3-iodopyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-cyclohex-2-en-1-yl-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135356347 |
| Molecular Formula | C11H12IN5 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(I)nn2C1C=CCCC1 |
| InChI | InChI=1S/C11H12IN5/c12-9-8-10(13)14-6-15-11(8)17(16-9)7-4-2-1-3-5-7/h2,4,6-7H,1,3,5H2,(H2,13,14,15) |
| InChIKey | AOVZMQKMXVQBRC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|