C17H28IN5OSi — CID 176774277
1-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 176774277) has the molecular formula C17H28IN5OSi and a molecular weight of 473.44 g/mol. Its IUPAC name is 1-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176774277 |
| Molecular Formula | C17H28IN5OSi |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 1-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@@H](n2nc(I)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C17H28IN5OSi/c1-17(2,3)25(4,5)24-12-8-6-7-11(9-12)23-16-13(14(18)22-23)15(19)20-10-21-16/h10-12H,6-9H2,1-5H3,(H2,19,20,21)/t11-,12-/m1/s1 |
| InChIKey | AHRJAQFIOLVLTE-VXGBXAGGSA-N |
| XLogP | 4.52 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|