C11H13N5 — CID 142531520
1-cyclobutyl-3-ethenylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 142531520) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-cyclobutyl-3-ethenylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-cyclobutyl-3-ethenylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142531520 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-cyclobutyl-3-ethenylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C=Cc1nn(C2CCC2)c2ncnc(N)c12 |
| InChI | InChI=1S/C11H13N5/c1-2-8-9-10(12)13-6-14-11(9)16(15-8)7-4-3-5-7/h2,6-7H,1,3-5H2,(H2,12,13,14) |
| InChIKey | PDTIKWNBNAWRBL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |