C16H18N6 — CID 58506790
3-(4-aminophenyl)-1-cyclopentylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 58506790) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-(4-aminophenyl)-1-cyclopentylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-aminophenyl)-1-cyclopentylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 58506790 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-(4-aminophenyl)-1-cyclopentylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ccc(-c2nn(C3CCCC3)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C16H18N6/c17-11-7-5-10(6-8-11)14-13-15(18)19-9-20-16(13)22(21-14)12-3-1-2-4-12/h5-9,12H,1-4,17H2,(H2,18,19,20) |
| InChIKey | SEXAYLNYIQBGFT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|