C19H22N6O2 — CID 164854514
3-(4-aminophenyl)-1-(1,4-dioxaspiro[4.5]decan-8-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 164854514) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-(4-aminophenyl)-1-(1,4-dioxaspiro[4.5]decan-8-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-aminophenyl)-1-(1,4-dioxaspiro[4.5]decan-8-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164854514 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-(4-aminophenyl)-1-(1,4-dioxaspiro[4.5]decan-8-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ccc(-c2nn(C3CCC4(CC3)OCCO4)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C19H22N6O2/c20-13-3-1-12(2-4-13)16-15-17(21)22-11-23-18(15)25(24-16)14-5-7-19(8-6-14)26-9-10-27-19/h1-4,11,14H,5-10,20H2,(H2,21,22,23) |
| InChIKey | ZOKJSIJKMURNSO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|