C12H16N6O6S — CID 153295301
[(2R,3S,4R,5R)-5-(4-amino-3-ethenylpyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 153295301) has the molecular formula C12H16N6O6S and a molecular weight of 372.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-3-ethenylpyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-3-ethenylpyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 153295301 |
| Molecular Formula | C12H16N6O6S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-3-ethenylpyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | C=Cc1nn([C@@H]2O[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H16N6O6S/c1-2-5-7-10(13)15-4-16-11(7)18(17-5)12-9(20)8(19)6(24-12)3-23-25(14,21)22/h2,4,6,8-9,12,19-20H,1,3H2,(H2,13,15,16)(H2,14,21,22)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | BONWUYUHOXPHBH-WOUKDFQISA-N |
| XLogP | -2.11 |
| TPSA | 188.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |