C17H24N6O6S2 — CID 134500640
[(2R,3S,4R,5R)-5-[4-amino-3-(cyclohexen-1-ylmethylsulfanyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 134500640) has the molecular formula C17H24N6O6S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-amino-3-(cyclohexen-1-ylmethylsulfanyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-amino-3-(cyclohexen-1-ylmethylsulfanyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 134500640 |
| Molecular Formula | C17H24N6O6S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-amino-3-(cyclohexen-1-ylmethylsulfanyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | Nc1ncnc2c1c(SCC1=CCCCC1)nn2[C@@H]1O[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24N6O6S2/c18-14-11-15(21-8-20-14)23(22-16(11)30-7-9-4-2-1-3-5-9)17-13(25)12(24)10(29-17)6-28-31(19,26)27/h4,8,10,12-13,17,24-25H,1-3,5-7H2,(H2,18,20,21)(H2,19,26,27)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | WPCXPUTTXKYRBT-CNEMSGBDSA-N |
| XLogP | -0.16 |
| TPSA | 188.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|