C15H17ClN6O7S2 — CID 134500446
[(2R,3S,4R,5R)-5-[4-amino-3-[(5-chlorofuran-2-yl)methylsulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 134500446) has the molecular formula C15H17ClN6O7S2 and a molecular weight of 492.92 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-amino-3-[(5-chlorofuran-2-yl)methylsulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-amino-3-[(5-chlorofuran-2-yl)methylsulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 134500446 |
| Molecular Formula | C15H17ClN6O7S2 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-amino-3-[(5-chlorofuran-2-yl)methylsulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | Nc1ncnc2c1c(SCc1ccc(Cl)o1)nn2[C@@H]1O[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H17ClN6O7S2/c16-8-2-1-6(28-8)4-30-14-9-12(17)19-5-20-13(9)22(21-14)15-11(24)10(23)7(29-15)3-27-31(18,25)26/h1-2,5,7,10-11,15,23-24H,3-4H2,(H2,17,19,20)(H2,18,25,26)/t7-,10-,11-,15-/m1/s1 |
| InChIKey | WJAOGVGHJBDIKK-YPKZDWGUSA-N |
| XLogP | -0.21 |
| TPSA | 201.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |