C15H15FN8O7S2 — CID 153295392
[(2R,3R,4S,5R)-5-[4-amino-3-[(5-nitro-2-pyridinyl)sulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 153295392) has the molecular formula C15H15FN8O7S2 and a molecular weight of 502.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-[4-amino-3-[(5-nitro-2-pyridinyl)sulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3R,4S,5R)-5-[4-amino-3-[(5-nitro-2-pyridinyl)sulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 153295392 |
| Molecular Formula | C15H15FN8O7S2 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | [(2R,3R,4S,5R)-5-[4-amino-3-[(5-nitro-2-pyridinyl)sulfanyl]pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | Nc1ncnc2c1c(Sc1ccc([N+](=O)[O-])cn1)nn2[C@@H]1O[C@H](COS(N)(=O)=O)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C15H15FN8O7S2/c16-10-11(25)7(4-30-33(18,28)29)31-15(10)23-13-9(12(17)20-5-21-13)14(22-23)32-8-2-1-6(3-19-8)24(26)27/h1-3,5,7,10-11,15,25H,4H2,(H2,17,20,21)(H2,18,28,29)/t7-,10+,11-,15-/m1/s1 |
| InChIKey | AJRJPPKWTNOSMI-YRWRXJCHSA-N |
| XLogP | -0.32 |
| TPSA | 224.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|