C17H20N6O6S2 — CID 153295256
[(2R,3S,4R,5R)-5-[4-amino-3-(3-methylphenyl)sulfanylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate (PubChem CID 153295256) has the molecular formula C17H20N6O6S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-amino-3-(3-methylphenyl)sulfanylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-amino-3-(3-methylphenyl)sulfanylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 153295256 |
| Molecular Formula | C17H20N6O6S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-amino-3-(3-methylphenyl)sulfanylpyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| SMILES | Cc1cccc(Sc2nn([C@@H]3O[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]3O)c3ncnc(N)c23)c1 |
| InChI | InChI=1S/C17H20N6O6S2/c1-8-3-2-4-9(5-8)30-16-11-14(18)20-7-21-15(11)23(22-16)17-13(25)12(24)10(29-17)6-28-31(19,26)27/h2-5,7,10,12-13,17,24-25H,6H2,1H3,(H2,18,20,21)(H2,19,26,27)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | YPIQMHCQPHVWIF-CNEMSGBDSA-N |
| XLogP | -0.29 |
| TPSA | 188.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |