C5H7N7 — CID 146204459
3-(aminomethyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 146204459) has the molecular formula C5H7N7 and a molecular weight of 165.16 g/mol. Its IUPAC name is 3-(aminomethyl)triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-(aminomethyl)triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 146204459 |
| Molecular Formula | C5H7N7 |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-(aminomethyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | NCn1nnc2c(N)ncnc21 |
| InChI | InChI=1S/C5H7N7/c6-1-12-5-3(10-11-12)4(7)8-2-9-5/h2H,1,6H2,(H2,7,8,9) |
| InChIKey | QTNIIKFHYLPTCU-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |