C10H14N6NaO2+ — CID 54602738
sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid (PubChem CID 54602738) has the molecular formula C10H14N6NaO2+ and a molecular weight of 273.25 g/mol. Its IUPAC name is sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid.
| Compound Name | sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 54602738 |
| Molecular Formula | C10H14N6NaO2+ |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid |
| SMILES | Nc1ncnc2c1nnn2CCCCCC(=O)O.[Na+] |
| InChI | InChI=1S/C10H14N6O2.Na/c11-9-8-10(13-6-12-9)16(15-14-8)5-3-1-2-4-7(17)18;/h6H,1-5H2,(H,17,18)(H2,11,12,13);/q;+1 |
| InChIKey | MXOBVIKDYCRHJW-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|