About sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid
sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid (PubChem CID 54602738) has the molecular formula C10H14N6NaO2+
and a molecular weight of 273.25 g/mol. Its IUPAC name is sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid.
Molecular Properties
| Compound Name | sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid |
| PubChem CID | 54602738 |
| Molecular Formula | C10H14N6NaO2+ |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid |
| SMILES | Nc1ncnc2c1nnn2CCCCCC(=O)O.[Na+] |
| InChI | InChI=1S/C10H14N6O2.Na/c11-9-8-10(13-6-12-9)16(15-14-8)5-3-1-2-4-7(17)18;/h6H,1-5H2,(H,17,18)(H2,11,12,13);/q;+1 |
| InChIKey | MXOBVIKDYCRHJW-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid?
The IUPAC name of sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid (CID 54602738) is sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid.
What is the SMILES notation for sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid?
The canonical SMILES for sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid is Nc1ncnc2c1nnn2CCCCCC(=O)O.[Na+].
What is the InChIKey of sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid?
The InChIKey is MXOBVIKDYCRHJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O2.Na/c11-9-8-10(13-6-12-9)16(15-14-8)5-3-1-2-4-7(17)18;/h6H,1-5H2,(H,17,18)(H2,11,12,13);/q;+1.
What are the key properties of sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid?
sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid has a molecular weight of 273.25 g/mol, XLogP of -2.55, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 6-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)hexanoic acid is sourced from PubChem (CID 54602738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).