C4H6N8 — CID 167078631
3-hydrazinyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 167078631) has the molecular formula C4H6N8 and a molecular weight of 166.15 g/mol. Its IUPAC name is 3-hydrazinyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-hydrazinyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 167078631 |
| Molecular Formula | C4H6N8 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 3-hydrazinyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | NNn1nnc2c(N)ncnc21 |
| InChI | InChI=1S/C4H6N8/c5-3-2-4(8-1-7-3)12(10-6)11-9-2/h1,10H,6H2,(H2,5,7,8) |
| InChIKey | AMLVXXCPUNANST-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|