About (6-aminopurin-9-yl)urea
(6-aminopurin-9-yl)urea (PubChem CID 57269838) has the molecular formula C6H7N7O
and a molecular weight of 193.17 g/mol. Its IUPAC name is (6-aminopurin-9-yl)urea.
Molecular Properties
| Compound Name | (6-aminopurin-9-yl)urea |
| PubChem CID | 57269838 |
| Molecular Formula | C6H7N7O |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (6-aminopurin-9-yl)urea |
| SMILES | NC(=O)Nn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C6H7N7O/c7-4-3-5(10-1-9-4)13(2-11-3)12-6(8)14/h1-2H,(H2,7,9,10)(H3,8,12,14) |
| InChIKey | VMXWZNVXISCUHL-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-aminopurin-9-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-aminopurin-9-yl)urea?
The IUPAC name of (6-aminopurin-9-yl)urea (CID 57269838) is (6-aminopurin-9-yl)urea.
What is the SMILES notation for (6-aminopurin-9-yl)urea?
The canonical SMILES for (6-aminopurin-9-yl)urea is NC(=O)Nn1cnc2c(N)ncnc21.
What is the InChIKey of (6-aminopurin-9-yl)urea?
The InChIKey is VMXWZNVXISCUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N7O/c7-4-3-5(10-1-9-4)13(2-11-3)12-6(8)14/h1-2H,(H2,7,9,10)(H3,8,12,14).
What are the key properties of (6-aminopurin-9-yl)urea?
(6-aminopurin-9-yl)urea has a molecular weight of 193.17 g/mol, XLogP of -0.97, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-aminopurin-9-yl)urea is sourced from PubChem (CID 57269838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).