C11H9N7O — CID 57322773
N-(6-aminopurin-9-yl)pyridine-3-carboxamide (PubChem CID 57322773) has the molecular formula C11H9N7O and a molecular weight of 255.24 g/mol. Its IUPAC name is N-(6-aminopurin-9-yl)pyridine-3-carboxamide.
| Compound Name | N-(6-aminopurin-9-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57322773 |
| Molecular Formula | C11H9N7O |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(6-aminopurin-9-yl)pyridine-3-carboxamide |
| SMILES | Nc1ncnc2c1ncn2NC(=O)c1cccnc1 |
| InChI | InChI=1S/C11H9N7O/c12-9-8-10(15-5-14-9)18(6-16-8)17-11(19)7-2-1-3-13-4-7/h1-6H,(H,17,19)(H2,12,14,15) |
| InChIKey | PSXYNWXXZHLBCI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |