C12H9ClN6O — CID 134094128
6-amino-N-(4-chlorophenyl)purine-9-carboxamide (PubChem CID 134094128) has the molecular formula C12H9ClN6O and a molecular weight of 288.70 g/mol. Its IUPAC name is 6-amino-N-(4-chlorophenyl)purine-9-carboxamide.
| Compound Name | 6-amino-N-(4-chlorophenyl)purine-9-carboxamide |
|---|---|
| PubChem CID | 134094128 |
| Molecular Formula | C12H9ClN6O |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 6-amino-N-(4-chlorophenyl)purine-9-carboxamide |
| SMILES | Nc1ncnc2c1ncn2C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9ClN6O/c13-7-1-3-8(4-2-7)18-12(20)19-6-17-9-10(14)15-5-16-11(9)19/h1-6H,(H,18,20)(H2,14,15,16) |
| InChIKey | CFTCGGRBFITROX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |