About 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine
3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 139295565) has the molecular formula C10H6F2N6
and a molecular weight of 248.20 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 139295565 |
| Molecular Formula | C10H6F2N6 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2c1nnn2-c1c(F)cccc1F |
| InChI | InChI=1S/C10H6F2N6/c11-5-2-1-3-6(12)8(5)18-10-7(16-17-18)9(13)14-4-15-10/h1-4H,(H2,13,14,15) |
| InChIKey | SNXZPTHRUOYHMV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine (CID 139295565) is 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine is Nc1ncnc2c1nnn2-c1c(F)cccc1F.
What is the InChIKey of 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is SNXZPTHRUOYHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N6/c11-5-2-1-3-6(12)8(5)18-10-7(16-17-18)9(13)14-4-15-10/h1-4H,(H2,13,14,15).
What are the key properties of 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine?
3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 248.20 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-difluorophenyl)triazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 139295565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).