C11H18N6 — CID 142638159
3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 142638159) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 142638159 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCCC(CCC)n1nnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H18N6/c1-3-5-8(6-4-2)17-11-9(15-16-17)10(12)13-7-14-11/h7-8H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | DFTJMNKEBAHDKE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |