About 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine
3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 142638159) has the molecular formula C11H18N6
and a molecular weight of 234.31 g/mol. Its IUPAC name is 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 142638159 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCCC(CCC)n1nnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H18N6/c1-3-5-8(6-4-2)17-11-9(15-16-17)10(12)13-7-14-11/h7-8H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | DFTJMNKEBAHDKE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine (CID 142638159) is 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine is CCCC(CCC)n1nnc2c(N)ncnc21.
What is the InChIKey of 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is DFTJMNKEBAHDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N6/c1-3-5-8(6-4-2)17-11-9(15-16-17)10(12)13-7-14-11/h7-8H,3-6H2,1-2H3,(H2,12,13,14).
What are the key properties of 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine?
3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 234.31 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptan-4-yltriazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 142638159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).