C10H14N6 — CID 90792997
3-cyclohexyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 90792997) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-cyclohexyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-cyclohexyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 90792997 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 3-cyclohexyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2c1nnn2C1CCCCC1 |
| InChI | InChI=1S/C10H14N6/c11-9-8-10(13-6-12-9)16(15-14-8)7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,11,12,13) |
| InChIKey | FJYYQQJRAMYZPG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |