C7H11N7 — CID 57290329
8-(2-aminoethyl)purine-6,9-diamine (PubChem CID 57290329) has the molecular formula C7H11N7 and a molecular weight of 193.21 g/mol. Its IUPAC name is 8-(2-aminoethyl)purine-6,9-diamine.
| Compound Name | 8-(2-aminoethyl)purine-6,9-diamine |
|---|---|
| PubChem CID | 57290329 |
| Molecular Formula | C7H11N7 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 8-(2-aminoethyl)purine-6,9-diamine |
| SMILES | NCCc1nc2c(N)ncnc2n1N |
| InChI | InChI=1S/C7H11N7/c8-2-1-4-13-5-6(9)11-3-12-7(5)14(4)10/h3H,1-2,8,10H2,(H2,9,11,12) |
| InChIKey | FNPDGZBGGQORNS-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |