C8H9N5S — CID 130016922
8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-4-amine (PubChem CID 130016922) has the molecular formula C8H9N5S and a molecular weight of 207.26 g/mol. Its IUPAC name is 8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-4-amine.
| Compound Name | 8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-4-amine |
|---|---|
| PubChem CID | 130016922 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-4-amine |
| SMILES | Nc1ncnc2c1nc1n2CCCS1 |
| InChI | InChI=1S/C8H9N5S/c9-6-5-7(11-4-10-6)13-2-1-3-14-8(13)12-5/h4H,1-3H2,(H2,9,10,11) |
| InChIKey | OJSGMNUVOYGVHZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |