C13H18BN6O2 — CID 160881085
CID 160881085 (PubChem CID 160881085) has the molecular formula C13H18BN6O2 and a molecular weight of 301.14 g/mol.
| Compound Name | CID 160881085 |
|---|---|
| PubChem CID | 160881085 |
| Molecular Formula | C13H18BN6O2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | — |
| SMILES | CC(C)/C=C/[C@@H]1C[C@@H](O)[C@H](n2nnc3c(N)ncnc32)O1.[B] |
| InChI | InChI=1S/C13H18N6O2.B/c1-7(2)3-4-8-5-9(20)13(21-8)19-12-10(17-18-19)11(14)15-6-16-12;/h3-4,6-9,13,20H,5H2,1-2H3,(H2,14,15,16);/b4-3+;/t8-,9-,13-;/m1./s1 |
| InChIKey | GRQKBJHCSAVPIS-QSYDEJDSSA-N |
| XLogP | 0.28 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|