C11H14N5O6P — CID 25152538
[(E)-2-[(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 25152538) has the molecular formula C11H14N5O6P and a molecular weight of 343.24 g/mol. Its IUPAC name is [(E)-2-[(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 25152538 |
| Molecular Formula | C11H14N5O6P |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [(E)-2-[(2R,3S,4R,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | Nc1ncnc2c1cnn2[C@@H]1O[C@H](/C=C/P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H14N5O6P/c12-9-5-3-15-16(10(5)14-4-13-9)11-8(18)7(17)6(22-11)1-2-23(19,20)21/h1-4,6-8,11,17-18H,(H2,12,13,14)(H2,19,20,21)/b2-1+/t6-,7-,8-,11-/m1/s1 |
| InChIKey | MRLVRLAKAXAHQV-HHBZMTIVSA-N |
| XLogP | -1.28 |
| TPSA | 176.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|