C10H14N3O7P — CID 59289226
[(E)-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 59289226) has the molecular formula C10H14N3O7P and a molecular weight of 319.21 g/mol. Its IUPAC name is [(E)-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 59289226 |
| Molecular Formula | C10H14N3O7P |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [(E)-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(3-methylidene-5-oxo-1,2,4-triazin-2-yl)oxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | C=C1NC(=O)C=NN1[C@@H]1O[C@H](/C=C/P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N3O7P/c1-5-12-7(14)4-11-13(5)10-9(16)8(15)6(20-10)2-3-21(17,18)19/h2-4,6,8-10,15-16H,1H2,(H,12,14)(H2,17,18,19)/b3-2+/t6-,8-,9-,10-/m1/s1 |
| InChIKey | ZEQSLXQEAXMZKJ-UTZMOGTHSA-N |
| XLogP | -1.99 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|