C11H13N3O5 — CID 175625930
2-[(2R,4R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylidene-1,2,4-triazin-5-one (PubChem CID 175625930) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-[(2R,4R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylidene-1,2,4-triazin-5-one.
| Compound Name | 2-[(2R,4R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylidene-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 175625930 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[(2R,4R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylidene-1,2,4-triazin-5-one |
| SMILES | C#C[C@]1(CO)O[C@@H](N2N=CC(=O)NC2=C)C(O)[C@H]1O |
| InChI | InChI=1S/C11H13N3O5/c1-3-11(5-15)9(18)8(17)10(19-11)14-6(2)13-7(16)4-12-14/h1,4,8-10,15,17-18H,2,5H2,(H,13,16)/t8?,9-,10-,11-/m1/s1 |
| InChIKey | BITYZBWYGOWMSZ-NCYANSMOSA-N |
| XLogP | -2.68 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|