C31H39N7O6 — CID 130419101
tert-butyl 7-[[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1,7-diazaspiro[3.4]octane-1-carboxylate (PubChem CID 130419101) has the molecular formula C31H39N7O6 and a molecular weight of 605.70 g/mol. Its IUPAC name is tert-butyl 7-[[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1,7-diazaspiro[3.4]octane-1-carboxylate.
| Compound Name | tert-butyl 7-[[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1,7-diazaspiro[3.4]octane-1-carboxylate |
|---|---|
| PubChem CID | 130419101 |
| Molecular Formula | C31H39N7O6 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | tert-butyl 7-[[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1,7-diazaspiro[3.4]octane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCN(C[C@H]1O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@H]3OC(C)(C)O[C@@H]31)C2 |
| InChI | InChI=1S/C31H39N7O6/c1-29(2,3)44-28(40)38-14-12-31(38)11-13-36(16-31)15-20-22-23(43-30(4,5)42-22)27(41-20)37-18-34-21-24(32-17-33-25(21)37)35-26(39)19-9-7-6-8-10-19/h6-10,17-18,20,22-23,27H,11-16H2,1-5H3,(H,32,33,35,39)/t20-,22-,23-,27-,31?/m1/s1 |
| InChIKey | IZFHDTRAZPBMBI-POVMGHKJSA-N |
| XLogP | 3.58 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |