C19H22F2N6O4 — CID 155374705
(3aR,4R,6S,6aS)-4-[6-(2,2-difluoroethylamino)-2-prop-1-ynylpurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 155374705) has the molecular formula C19H22F2N6O4 and a molecular weight of 436.42 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-[6-(2,2-difluoroethylamino)-2-prop-1-ynylpurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-[6-(2,2-difluoroethylamino)-2-prop-1-ynylpurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 155374705 |
| Molecular Formula | C19H22F2N6O4 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-[6-(2,2-difluoroethylamino)-2-prop-1-ynylpurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CC#Cc1nc(NCC(F)F)c2ncn([C@@H]3O[C@H](C(=O)NC)[C@H]4OC(C)(C)O[C@H]43)c2n1 |
| InChI | InChI=1S/C19H22F2N6O4/c1-5-6-10-25-15(23-7-9(20)21)11-16(26-10)27(8-24-11)18-14-12(30-19(2,3)31-14)13(29-18)17(28)22-4/h8-9,12-14,18H,7H2,1-4H3,(H,22,28)(H,23,25,26)/t12-,13+,14-,18-/m1/s1 |
| InChIKey | XWCJVPWWLWOHAP-KYZVSKTDSA-N |
| XLogP | 1.04 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|