C17H20F2N8O4 — CID 155374792
[(3aR,4R,6R,6aR)-4-[6-(2,2-difluoroethylamino)-2-(2H-triazol-4-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 155374792) has the molecular formula C17H20F2N8O4 and a molecular weight of 438.40 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[6-(2,2-difluoroethylamino)-2-(2H-triazol-4-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-4-[6-(2,2-difluoroethylamino)-2-(2H-triazol-4-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 155374792 |
| Molecular Formula | C17H20F2N8O4 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[6-(2,2-difluoroethylamino)-2-(2H-triazol-4-yl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c(NCC(F)F)nc(-c3cn[nH]n3)nc21 |
| InChI | InChI=1S/C17H20F2N8O4/c1-17(2)30-11-8(5-28)29-16(12(11)31-17)27-6-21-10-14(20-4-9(18)19)23-13(24-15(10)27)7-3-22-26-25-7/h3,6,8-9,11-12,16,28H,4-5H2,1-2H3,(H,20,23,24)(H,22,25,26)/t8-,11-,12-,16-/m1/s1 |
| InChIKey | JMZIQLONOZQHLB-LKGUXBDMSA-N |
| XLogP | 0.70 |
| TPSA | 145.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |