C17H21IN6O4 — CID 155369667
(3aR,4R,6S,6aS)-4-[6-(cyclopropylamino)-2-iodopurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 155369667) has the molecular formula C17H21IN6O4 and a molecular weight of 500.30 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-[6-(cyclopropylamino)-2-iodopurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-[6-(cyclopropylamino)-2-iodopurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 155369667 |
| Molecular Formula | C17H21IN6O4 |
| Molecular Weight | 500.30 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-[6-(cyclopropylamino)-2-iodopurin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NC4CC4)nc(I)nc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H21IN6O4/c1-17(2)27-9-10(14(25)19-3)26-15(11(9)28-17)24-6-20-8-12(21-7-4-5-7)22-16(18)23-13(8)24/h6-7,9-11,15H,4-5H2,1-3H3,(H,19,25)(H,21,22,23)/t9-,10+,11-,15-/m1/s1 |
| InChIKey | IWKPWPNDSFWQTF-JNIYBQFBSA-N |
| XLogP | 1.17 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|