C26H28N8O6 — CID 69195028
(3aR,4R,6S,6aR)-2,2-dimethyl-4-[2-[4-(4-methylphenyl)triazol-4-yl]-6-(oxolan-3-ylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid (PubChem CID 69195028) has the molecular formula C26H28N8O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is (3aR,4R,6S,6aR)-2,2-dimethyl-4-[2-[4-(4-methylphenyl)triazol-4-yl]-6-(oxolan-3-ylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid.
| Compound Name | (3aR,4R,6S,6aR)-2,2-dimethyl-4-[2-[4-(4-methylphenyl)triazol-4-yl]-6-(oxolan-3-ylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 69195028 |
| Molecular Formula | C26H28N8O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (3aR,4R,6S,6aR)-2,2-dimethyl-4-[2-[4-(4-methylphenyl)triazol-4-yl]-6-(oxolan-3-ylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid |
| SMILES | Cc1ccc(C2(c3nc(NC4CCOC4)c4ncn([C@@H]5O[C@H](C(=O)O)[C@@H]6OC(C)(C)O[C@H]65)c4n3)C=NN=N2)cc1 |
| InChI | InChI=1S/C26H28N8O6/c1-13-4-6-14(7-5-13)26(11-28-33-32-26)24-30-20(29-15-8-9-37-10-15)16-21(31-24)34(12-27-16)22-18-17(19(38-22)23(35)36)39-25(2,3)40-18/h4-7,11-12,15,17-19,22H,8-10H2,1-3H3,(H,35,36)(H,29,30,31)/t15?,17-,18-,19+,22-,26?/m1/s1 |
| InChIKey | WPWRNFMCZSJLBF-RKAAONEPSA-N |
| XLogP | 2.53 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |