C30H37N7O4 — CID 143334721
[(3aR,4S,6R,6aR)-2-methyl-6-[2-[4-(4-methylphenyl)pyrazol-1-yl]-6-(oxolan-3-ylamino)purin-9-yl]-2-propyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol (PubChem CID 143334721) has the molecular formula C30H37N7O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-2-methyl-6-[2-[4-(4-methylphenyl)pyrazol-1-yl]-6-(oxolan-3-ylamino)purin-9-yl]-2-propyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol.
| Compound Name | [(3aR,4S,6R,6aR)-2-methyl-6-[2-[4-(4-methylphenyl)pyrazol-1-yl]-6-(oxolan-3-ylamino)purin-9-yl]-2-propyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol |
|---|---|
| PubChem CID | 143334721 |
| Molecular Formula | C30H37N7O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | [(3aR,4S,6R,6aR)-2-methyl-6-[2-[4-(4-methylphenyl)pyrazol-1-yl]-6-(oxolan-3-ylamino)purin-9-yl]-2-propyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol |
| SMILES | CCCC1(C)C[C@H]2[C@@H](O1)[C@H](n1cnc3c(NC4CCOC4)nc(-n4cc(-c5ccc(C)cc5)cn4)nc31)O[C@@H]2CO |
| InChI | InChI=1S/C30H37N7O4/c1-4-10-30(3)12-22-23(15-38)40-28(25(22)41-30)36-17-31-24-26(33-21-9-11-39-16-21)34-29(35-27(24)36)37-14-20(13-32-37)19-7-5-18(2)6-8-19/h5-8,13-14,17,21-23,25,28,38H,4,9-12,15-16H2,1-3H3,(H,33,34,35)/t21?,22-,23-,25-,28-,30?/m1/s1 |
| InChIKey | FIZDOHKVPJAVFN-UMDBNCDTSA-N |
| XLogP | 4.04 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |