C23H29N7O6 — CID 91219451
ethyl 3-[1-[6-(cyclopentylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazol-4-yl]prop-2-enoate (PubChem CID 91219451) has the molecular formula C23H29N7O6 and a molecular weight of 499.53 g/mol. Its IUPAC name is ethyl 3-[1-[6-(cyclopentylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl 3-[1-[6-(cyclopentylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91219451 |
| Molecular Formula | C23H29N7O6 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | ethyl 3-[1-[6-(cyclopentylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cnn(-c2nc(NC3CCCC3)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C23H29N7O6/c1-2-35-16(32)8-7-13-9-25-30(10-13)23-27-20(26-14-5-3-4-6-14)17-21(28-23)29(12-24-17)22-19(34)18(33)15(11-31)36-22/h7-10,12,14-15,18-19,22,31,33-34H,2-6,11H2,1H3,(H,26,27,28)/t15-,18-,19-,22-/m1/s1 |
| InChIKey | GOISBEJALOZVSK-CIVUBGFFSA-N |
| XLogP | 0.55 |
| TPSA | 169.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|