C23H25N7O6 — CID 11978420
ethyl 1-[6-(benzylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazole-4-carboxylate (PubChem CID 11978420) has the molecular formula C23H25N7O6 and a molecular weight of 495.50 g/mol. Its IUPAC name is ethyl 1-[6-(benzylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[6-(benzylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 11978420 |
| Molecular Formula | C23H25N7O6 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | ethyl 1-[6-(benzylamino)-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(NCc3ccccc3)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C23H25N7O6/c1-2-35-22(34)14-9-26-30(10-14)23-27-19(24-8-13-6-4-3-5-7-13)16-20(28-23)29(12-25-16)21-18(33)17(32)15(11-31)36-21/h3-7,9-10,12,15,17-18,21,31-33H,2,8,11H2,1H3,(H,24,27,28)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | DHZQKCYALVWGJR-QTQZEZTPSA-N |
| XLogP | 0.41 |
| TPSA | 169.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |